C22H18ClN5O3S — CID 175062717
4-[4-[(6-chloro-3-pyridinyl)-sulfinoamino]phenyl]-6-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 175062717) has the molecular formula C22H18ClN5O3S and a molecular weight of 467.94 g/mol. Its IUPAC name is 4-[4-[(6-chloro-3-pyridinyl)-sulfinoamino]phenyl]-6-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-[4-[(6-chloro-3-pyridinyl)-sulfinoamino]phenyl]-6-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 175062717 |
| Molecular Formula | C22H18ClN5O3S |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 4-[4-[(6-chloro-3-pyridinyl)-sulfinoamino]phenyl]-6-(cyclopropanecarbonylamino)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=C(Nc1cc(-c2ccc(N(c3ccc(Cl)nc3)S(=O)O)cc2)c2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C22H18ClN5O3S/c23-19-8-7-16(12-25-19)28(32(30)31)15-5-3-13(4-6-15)18-11-20(27-22(29)14-1-2-14)26-21-17(18)9-10-24-21/h3-12,14H,1-2H2,(H,30,31)(H2,24,26,27,29) |
| InChIKey | CFEZCJCDGOFDNF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|