C23H18N6OS — CID 138572291
N-[4-[4-[(6-cyano-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide (PubChem CID 138572291) has the molecular formula C23H18N6OS and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[4-[4-[(6-cyano-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[4-[4-[(6-cyano-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 138572291 |
| Molecular Formula | C23H18N6OS |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[4-[4-[(6-cyano-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
| SMILES | N#Cc1ccc(SNc2ccc(-c3cc(NC(=O)C4CC4)nc4[nH]ccc34)cc2)cn1 |
| InChI | InChI=1S/C23H18N6OS/c24-12-17-7-8-18(13-26-17)31-29-16-5-3-14(4-6-16)20-11-21(28-23(30)15-1-2-15)27-22-19(20)9-10-25-22/h3-11,13,15,29H,1-2H2,(H2,25,27,28,30) |
| InChIKey | QCAJHZHYFFQLNN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|