C20H17N5O2S — CID 138572373
N-[4-[4-[(6-methoxy-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide (PubChem CID 138572373) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is N-[4-[4-[(6-methoxy-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide.
| Compound Name | N-[4-[4-[(6-methoxy-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
|---|---|
| PubChem CID | 138572373 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[4-[4-[(6-methoxy-3-pyridinyl)sulfanylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
| SMILES | COc1ccc(SNc2ccc(-c3cc(NC=O)nc4[nH]ccc34)cc2)cn1 |
| InChI | InChI=1S/C20H17N5O2S/c1-27-19-7-6-15(11-22-19)28-25-14-4-2-13(3-5-14)17-10-18(23-12-26)24-20-16(17)8-9-21-20/h2-12,25H,1H3,(H2,21,23,24,26) |
| InChIKey | RDEWSOLHOMHMET-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|