About bromobenzene;2-pentylfluoren-1-one
bromobenzene;2-pentylfluoren-1-one (PubChem CID 175068754) has the molecular formula C24H23BrO
and a molecular weight of 407.35 g/mol. Its IUPAC name is bromobenzene;2-pentylfluoren-1-one.
Molecular Properties
| Compound Name | bromobenzene;2-pentylfluoren-1-one |
| PubChem CID | 175068754 |
| Molecular Formula | C24H23BrO |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | bromobenzene;2-pentylfluoren-1-one |
| SMILES | Brc1ccccc1.CCCCCC1=CC=C2C(=Cc3ccccc32)C1=O |
| InChI | InChI=1S/C18H18O.C6H5Br/c1-2-3-4-7-13-10-11-16-15-9-6-5-8-14(15)12-17(16)18(13)19;7-6-4-2-1-3-5-6/h5-6,8-12H,2-4,7H2,1H3;1-5H |
| InChIKey | VQQNRQFWGIBYQI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;2-pentylfluoren-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;2-pentylfluoren-1-one?
The IUPAC name of bromobenzene;2-pentylfluoren-1-one (CID 175068754) is bromobenzene;2-pentylfluoren-1-one.
What is the SMILES notation for bromobenzene;2-pentylfluoren-1-one?
The canonical SMILES for bromobenzene;2-pentylfluoren-1-one is Brc1ccccc1.CCCCCC1=CC=C2C(=Cc3ccccc32)C1=O.
What is the InChIKey of bromobenzene;2-pentylfluoren-1-one?
The InChIKey is VQQNRQFWGIBYQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O.C6H5Br/c1-2-3-4-7-13-10-11-16-15-9-6-5-8-14(15)12-17(16)18(13)19;7-6-4-2-1-3-5-6/h5-6,8-12H,2-4,7H2,1H3;1-5H.
What are the key properties of bromobenzene;2-pentylfluoren-1-one?
bromobenzene;2-pentylfluoren-1-one has a molecular weight of 407.35 g/mol, XLogP of 7.01, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;2-pentylfluoren-1-one is sourced from PubChem (CID 175068754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).