About gallane;trifluoroborane
gallane;trifluoroborane (PubChem CID 175070384) has the molecular formula H3BF3Ga
and a molecular weight of 140.55 g/mol. Its IUPAC name is gallane;trifluoroborane.
Molecular Properties
| Compound Name | gallane;trifluoroborane |
| PubChem CID | 175070384 |
| Molecular Formula | H3BF3Ga |
| Molecular Weight | 140.55 g/mol |
| Exact Mass | 139.95 |
| IUPAC Name | gallane;trifluoroborane |
| SMILES | FB(F)F.[GaH3] |
| InChI | InChI=1S/BF3.Ga.3H/c2-1(3)4;;;; |
| InChIKey | WYERSDYJPZTWCH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.55 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze gallane;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gallane;trifluoroborane?
The IUPAC name of gallane;trifluoroborane (CID 175070384) is gallane;trifluoroborane.
What is the SMILES notation for gallane;trifluoroborane?
The canonical SMILES for gallane;trifluoroborane is FB(F)F.[GaH3].
What is the InChIKey of gallane;trifluoroborane?
The InChIKey is WYERSDYJPZTWCH-UHFFFAOYSA-N. The full InChI is InChI=1S/BF3.Ga.3H/c2-1(3)4;;;;.
What are the key properties of gallane;trifluoroborane?
gallane;trifluoroborane has a molecular weight of 140.55 g/mol, XLogP of -0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gallane;trifluoroborane is sourced from PubChem (CID 175070384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).