C10H8Cl2F6O2 — CID 175070416
4-(1,2,2,3,3,3-hexafluoropropyl)benzoic acid;dihydrochloride (PubChem CID 175070416) has the molecular formula C10H8Cl2F6O2 and a molecular weight of 345.07 g/mol. Its IUPAC name is 4-(1,2,2,3,3,3-hexafluoropropyl)benzoic acid;dihydrochloride.
| Compound Name | 4-(1,2,2,3,3,3-hexafluoropropyl)benzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 175070416 |
| Molecular Formula | C10H8Cl2F6O2 |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 4-(1,2,2,3,3,3-hexafluoropropyl)benzoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)c1ccc(C(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H6F6O2.2ClH/c11-7(9(12,13)10(14,15)16)5-1-3-6(4-2-5)8(17)18;;/h1-4,7H,(H,17,18);2*1H |
| InChIKey | SLNZZNPYSMLKCB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|