About azane;pyridine-2,4-diamine;hydrate
azane;pyridine-2,4-diamine;hydrate (PubChem CID 175072071) has the molecular formula C5H12N4O
and a molecular weight of 144.18 g/mol. Its IUPAC name is azane;pyridine-2,4-diamine;hydrate.
Molecular Properties
| Compound Name | azane;pyridine-2,4-diamine;hydrate |
| PubChem CID | 175072071 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | azane;pyridine-2,4-diamine;hydrate |
| SMILES | N.Nc1ccnc(N)c1.O |
| InChI | InChI=1S/C5H7N3.H3N.H2O/c6-4-1-2-8-5(7)3-4;;/h1-3H,(H4,6,7,8);1H3;1H2 |
| InChIKey | NPSGHIGNNNTEJD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;pyridine-2,4-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;pyridine-2,4-diamine;hydrate?
The IUPAC name of azane;pyridine-2,4-diamine;hydrate (CID 175072071) is azane;pyridine-2,4-diamine;hydrate.
What is the SMILES notation for azane;pyridine-2,4-diamine;hydrate?
The canonical SMILES for azane;pyridine-2,4-diamine;hydrate is N.Nc1ccnc(N)c1.O.
What is the InChIKey of azane;pyridine-2,4-diamine;hydrate?
The InChIKey is NPSGHIGNNNTEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3.H3N.H2O/c6-4-1-2-8-5(7)3-4;;/h1-3H,(H4,6,7,8);1H3;1H2.
What are the key properties of azane;pyridine-2,4-diamine;hydrate?
azane;pyridine-2,4-diamine;hydrate has a molecular weight of 144.18 g/mol, XLogP of -0.42, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;pyridine-2,4-diamine;hydrate is sourced from PubChem (CID 175072071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).