C5H12N4O — CID 175072071
azane;pyridine-2,4-diamine;hydrate (PubChem CID 175072071) has the molecular formula C5H12N4O and a molecular weight of 144.18 g/mol. Its IUPAC name is azane;pyridine-2,4-diamine;hydrate.
| Compound Name | azane;pyridine-2,4-diamine;hydrate |
|---|---|
| PubChem CID | 175072071 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | azane;pyridine-2,4-diamine;hydrate |
| SMILES | N.Nc1ccnc(N)c1.O |
| InChI | InChI=1S/C5H7N3.H3N.H2O/c6-4-1-2-8-5(7)3-4;;/h1-3H,(H4,6,7,8);1H3;1H2 |
| InChIKey | NPSGHIGNNNTEJD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |