C6H13NO2 — CID 175072652
(2S,5S)-N,5-dimethyl-1,4-dioxan-2-amine (PubChem CID 175072652) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is (2S,5S)-N,5-dimethyl-1,4-dioxan-2-amine.
| Compound Name | (2S,5S)-N,5-dimethyl-1,4-dioxan-2-amine |
|---|---|
| PubChem CID | 175072652 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (2S,5S)-N,5-dimethyl-1,4-dioxan-2-amine |
| SMILES | CN[C@@H]1CO[C@@H](C)CO1 |
| InChI | InChI=1S/C6H13NO2/c1-5-3-9-6(7-2)4-8-5/h5-7H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | PFUGFOCTEDZKMF-WDSKDSINSA-N |
| XLogP | -0.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |