C38H42N2O10S — CID 175074102
methyl (2S)-3-phenyl-2-[[4-[[2,4,6-tris(1-methoxy-1-oxopropan-2-yl)phenyl]sulfonylamino]naphthalen-1-yl]amino]propanoate (PubChem CID 175074102) has the molecular formula C38H42N2O10S and a molecular weight of 718.83 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-[[4-[[2,4,6-tris(1-methoxy-1-oxopropan-2-yl)phenyl]sulfonylamino]naphthalen-1-yl]amino]propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-[[4-[[2,4,6-tris(1-methoxy-1-oxopropan-2-yl)phenyl]sulfonylamino]naphthalen-1-yl]amino]propanoate |
|---|---|
| PubChem CID | 175074102 |
| Molecular Formula | C38H42N2O10S |
| Molecular Weight | 718.83 g/mol |
| Exact Mass | 718.26 |
| IUPAC Name | methyl (2S)-3-phenyl-2-[[4-[[2,4,6-tris(1-methoxy-1-oxopropan-2-yl)phenyl]sulfonylamino]naphthalen-1-yl]amino]propanoate |
| SMILES | COC(=O)C(C)c1cc(C(C)C(=O)OC)c(S(=O)(=O)Nc2ccc(N[C@@H](Cc3ccccc3)C(=O)OC)c3ccccc23)c(C(C)C(=O)OC)c1 |
| InChI | InChI=1S/C38H42N2O10S/c1-22(35(41)47-4)26-20-29(23(2)36(42)48-5)34(30(21-26)24(3)37(43)49-6)51(45,46)40-32-18-17-31(27-15-11-12-16-28(27)32)39-33(38(44)50-7)19-25-13-9-8-10-14-25/h8-18,20-24,33,39-40H,19H2,1-7H3/t22?,23?,24?,33-/m0/s1 |
| InChIKey | BCSAULJSTSSGJK-AGWBWLEOSA-N |
| XLogP | 5.67 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.83 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|