C10H20F3NO6S2 — CID 175076028
4-(2-methylpyrrolidin-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonic acid (PubChem CID 175076028) has the molecular formula C10H20F3NO6S2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-(2-methylpyrrolidin-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonic acid.
| Compound Name | 4-(2-methylpyrrolidin-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175076028 |
| Molecular Formula | C10H20F3NO6S2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-(2-methylpyrrolidin-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonic acid |
| SMILES | CC1CCCN1CCCCS(=O)(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H19NO3S.CHF3O3S/c1-9-5-4-7-10(9)6-2-3-8-14(11,12)13;2-1(3,4)8(5,6)7/h9H,2-8H2,1H3,(H,11,12,13);(H,5,6,7) |
| InChIKey | ISMZJERKCLBLSO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|