C10H19NO5S — CID 175077291
[(2-methylpropan-2-yl)oxycarbonylamino] 1-cyclopropylethanesulfonate (PubChem CID 175077291) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino] 1-cyclopropylethanesulfonate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino] 1-cyclopropylethanesulfonate |
|---|---|
| PubChem CID | 175077291 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino] 1-cyclopropylethanesulfonate |
| SMILES | CC(C1CC1)S(=O)(=O)ONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO5S/c1-7(8-5-6-8)17(13,14)16-11-9(12)15-10(2,3)4/h7-8H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | UPDUYBIBVXTVGC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|