C24H23Cl2N5O3S — CID 175077762
N-[4-chloro-2-methyl-6-(propylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(3-sulfanylidenecyclobutyl)oxypyrazole-5-carboxamide (PubChem CID 175077762) has the molecular formula C24H23Cl2N5O3S and a molecular weight of 532.45 g/mol. Its IUPAC name is N-[4-chloro-2-methyl-6-(propylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(3-sulfanylidenecyclobutyl)oxypyrazole-5-carboxamide.
| Compound Name | N-[4-chloro-2-methyl-6-(propylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(3-sulfanylidenecyclobutyl)oxypyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175077762 |
| Molecular Formula | C24H23Cl2N5O3S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | N-[4-chloro-2-methyl-6-(propylcarbamoyl)phenyl]-1-(3-chloro-2-pyridinyl)-3-(3-sulfanylidenecyclobutyl)oxypyrazole-5-carboxamide |
| SMILES | CCCNC(=O)c1cc(Cl)cc(C)c1NC(=O)c1cc(OC2CC(=S)C2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C24H23Cl2N5O3S/c1-3-6-28-23(32)17-9-14(25)8-13(2)21(17)29-24(33)19-12-20(34-15-10-16(35)11-15)30-31(19)22-18(26)5-4-7-27-22/h4-5,7-9,12,15H,3,6,10-11H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | VLBCGKZHWGRIHS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|