C25H23Cl2N5O3S — CID 175082921
N-[2-(butylcarbamoyl)-4-chloro-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-thiophen-3-yloxypyrazole-5-carboxamide (PubChem CID 175082921) has the molecular formula C25H23Cl2N5O3S and a molecular weight of 544.46 g/mol. Its IUPAC name is N-[2-(butylcarbamoyl)-4-chloro-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-thiophen-3-yloxypyrazole-5-carboxamide.
| Compound Name | N-[2-(butylcarbamoyl)-4-chloro-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-thiophen-3-yloxypyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175082921 |
| Molecular Formula | C25H23Cl2N5O3S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | N-[2-(butylcarbamoyl)-4-chloro-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-thiophen-3-yloxypyrazole-5-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Cl)cc(C)c1NC(=O)c1cc(Oc2ccsc2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C25H23Cl2N5O3S/c1-3-4-8-29-24(33)18-12-16(26)11-15(2)22(18)30-25(34)20-13-21(35-17-7-10-36-14-17)31-32(20)23-19(27)6-5-9-28-23/h5-7,9-14H,3-4,8H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | RXEUTTLXGFTRMX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|