C13H16N6O — CID 175079402
4-[(3S)-3-methylmorpholin-4-yl]-5-pyrimidin-4-ylpyrimidin-2-amine (PubChem CID 175079402) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-[(3S)-3-methylmorpholin-4-yl]-5-pyrimidin-4-ylpyrimidin-2-amine.
| Compound Name | 4-[(3S)-3-methylmorpholin-4-yl]-5-pyrimidin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 175079402 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-[(3S)-3-methylmorpholin-4-yl]-5-pyrimidin-4-ylpyrimidin-2-amine |
| SMILES | C[C@H]1COCCN1c1nc(N)ncc1-c1ccncn1 |
| InChI | InChI=1S/C13H16N6O/c1-9-7-20-5-4-19(9)12-10(6-16-13(14)18-12)11-2-3-15-8-17-11/h2-3,6,8-9H,4-5,7H2,1H3,(H2,14,16,18)/t9-/m0/s1 |
| InChIKey | QYPZUQUPSNQUAO-VIFPVBQESA-N |
| XLogP | 0.74 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |