C24H29NO3 — CID 175080447
5-[(E)-5-(methoxymethoxy)pent-2-en-2-yl]-2-(4-phenylbutoxy)benzonitrile (PubChem CID 175080447) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-[(E)-5-(methoxymethoxy)pent-2-en-2-yl]-2-(4-phenylbutoxy)benzonitrile.
| Compound Name | 5-[(E)-5-(methoxymethoxy)pent-2-en-2-yl]-2-(4-phenylbutoxy)benzonitrile |
|---|---|
| PubChem CID | 175080447 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 5-[(E)-5-(methoxymethoxy)pent-2-en-2-yl]-2-(4-phenylbutoxy)benzonitrile |
| SMILES | COCOCC/C=C(\C)c1ccc(OCCCCc2ccccc2)c(C#N)c1 |
| InChI | InChI=1S/C24H29NO3/c1-20(9-8-15-27-19-26-2)22-13-14-24(23(17-22)18-25)28-16-7-6-12-21-10-4-3-5-11-21/h3-5,9-11,13-14,17H,6-8,12,15-16,19H2,1-2H3/b20-9+ |
| InChIKey | DFCWRSOJJKFIBK-AWQFTUOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|