C25H29N5O3 — CID 175081011
[4-[N-(benzylcarbamoyl)-4-(1-methylpyrazol-4-yl)anilino]cyclohexyl] carbamate (PubChem CID 175081011) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is [4-[N-(benzylcarbamoyl)-4-(1-methylpyrazol-4-yl)anilino]cyclohexyl] carbamate.
| Compound Name | [4-[N-(benzylcarbamoyl)-4-(1-methylpyrazol-4-yl)anilino]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175081011 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [4-[N-(benzylcarbamoyl)-4-(1-methylpyrazol-4-yl)anilino]cyclohexyl] carbamate |
| SMILES | Cn1cc(-c2ccc(N(C(=O)NCc3ccccc3)C3CCC(OC(N)=O)CC3)cc2)cn1 |
| InChI | InChI=1S/C25H29N5O3/c1-29-17-20(16-28-29)19-7-9-21(10-8-19)30(22-11-13-23(14-12-22)33-24(26)31)25(32)27-15-18-5-3-2-4-6-18/h2-10,16-17,22-23H,11-15H2,1H3,(H2,26,31)(H,27,32) |
| InChIKey | QFULUIISECMHAE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |