C30H36N6O — CID 175620809
3-benzyl-1-[4-(1-methylpyrazol-4-yl)phenyl]-1-[(4S)-1-(pyridin-2-ylamino)heptan-4-yl]urea (PubChem CID 175620809) has the molecular formula C30H36N6O and a molecular weight of 496.66 g/mol. Its IUPAC name is 3-benzyl-1-[4-(1-methylpyrazol-4-yl)phenyl]-1-[(4S)-1-(pyridin-2-ylamino)heptan-4-yl]urea.
| Compound Name | 3-benzyl-1-[4-(1-methylpyrazol-4-yl)phenyl]-1-[(4S)-1-(pyridin-2-ylamino)heptan-4-yl]urea |
|---|---|
| PubChem CID | 175620809 |
| Molecular Formula | C30H36N6O |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 3-benzyl-1-[4-(1-methylpyrazol-4-yl)phenyl]-1-[(4S)-1-(pyridin-2-ylamino)heptan-4-yl]urea |
| SMILES | CCC[C@@H](CCCNc1ccccn1)N(C(=O)NCc1ccccc1)c1ccc(-c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C30H36N6O/c1-3-10-27(13-9-20-32-29-14-7-8-19-31-29)36(30(37)33-21-24-11-5-4-6-12-24)28-17-15-25(16-18-28)26-22-34-35(2)23-26/h4-8,11-12,14-19,22-23,27H,3,9-10,13,20-21H2,1-2H3,(H,31,32)(H,33,37)/t27-/m0/s1 |
| InChIKey | XBFMLRATZXVOOI-MHZLTWQESA-N |
| XLogP | 6.26 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|