C15H17NO2 — CID 175081432
4-methoxy-2-methylaniline;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene (PubChem CID 175081432) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-methoxy-2-methylaniline;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene.
| Compound Name | 4-methoxy-2-methylaniline;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
|---|---|
| PubChem CID | 175081432 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-methoxy-2-methylaniline;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
| SMILES | COc1ccc(N)c(C)c1.c1cc2cc(c1)OC2 |
| InChI | InChI=1S/C8H11NO.C7H6O/c1-6-5-7(10-2)3-4-8(6)9;1-2-6-4-7(3-1)8-5-6/h3-5H,9H2,1-2H3;1-4H,5H2 |
| InChIKey | AMYLAIIEUUKQNJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|