C33H39O5P — CID 175082704
2,4-diphenyl-3-(9-phenylnonyl)phenol;phosphoric acid (PubChem CID 175082704) has the molecular formula C33H39O5P and a molecular weight of 546.64 g/mol. Its IUPAC name is 2,4-diphenyl-3-(9-phenylnonyl)phenol;phosphoric acid.
| Compound Name | 2,4-diphenyl-3-(9-phenylnonyl)phenol;phosphoric acid |
|---|---|
| PubChem CID | 175082704 |
| Molecular Formula | C33H39O5P |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 2,4-diphenyl-3-(9-phenylnonyl)phenol;phosphoric acid |
| SMILES | O=P(O)(O)O.Oc1ccc(-c2ccccc2)c(CCCCCCCCCc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C33H36O.H3O4P/c34-32-26-25-30(28-20-12-7-13-21-28)31(33(32)29-22-14-8-15-23-29)24-16-5-3-1-2-4-9-17-27-18-10-6-11-19-27;1-5(2,3)4/h6-8,10-15,18-23,25-26,34H,1-5,9,16-17,24H2;(H3,1,2,3,4) |
| InChIKey | CAGOPJBNOSGEOB-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|