About sodium (4-methoxyphenyl) sulfite
sodium (4-methoxyphenyl) sulfite (PubChem CID 175083766) has the molecular formula C7H7NaO4S
and a molecular weight of 210.19 g/mol. Its IUPAC name is sodium (4-methoxyphenyl) sulfite.
Molecular Properties
| Compound Name | sodium (4-methoxyphenyl) sulfite |
| PubChem CID | 175083766 |
| Molecular Formula | C7H7NaO4S |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | sodium (4-methoxyphenyl) sulfite |
| SMILES | COc1ccc(OS(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C7H8O4S.Na/c1-10-6-2-4-7(5-3-6)11-12(8)9;/h2-5H,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | JQPLONLCLGYXPG-UHFFFAOYSA-M |
| XLogP | -2.13 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium (4-methoxyphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (4-methoxyphenyl) sulfite?
The IUPAC name of sodium (4-methoxyphenyl) sulfite (CID 175083766) is sodium (4-methoxyphenyl) sulfite.
What is the SMILES notation for sodium (4-methoxyphenyl) sulfite?
The canonical SMILES for sodium (4-methoxyphenyl) sulfite is COc1ccc(OS(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium (4-methoxyphenyl) sulfite?
The InChIKey is JQPLONLCLGYXPG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O4S.Na/c1-10-6-2-4-7(5-3-6)11-12(8)9;/h2-5H,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of sodium (4-methoxyphenyl) sulfite?
sodium (4-methoxyphenyl) sulfite has a molecular weight of 210.19 g/mol, XLogP of -2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (4-methoxyphenyl) sulfite is sourced from PubChem (CID 175083766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).