C6H3Br2O3S- — CID 57145113
(3,4-dibromophenyl) sulfite (PubChem CID 57145113) has the molecular formula C6H3Br2O3S- and a molecular weight of 314.96 g/mol. Its IUPAC name is (3,4-dibromophenyl) sulfite.
| Compound Name | (3,4-dibromophenyl) sulfite |
|---|---|
| PubChem CID | 57145113 |
| Molecular Formula | C6H3Br2O3S- |
| Molecular Weight | 314.96 g/mol |
| Exact Mass | 312.82 |
| IUPAC Name | (3,4-dibromophenyl) sulfite |
| SMILES | O=S([O-])Oc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C6H4Br2O3S/c7-5-2-1-4(3-6(5)8)11-12(9)10/h1-3H,(H,9,10)/p-1 |
| InChIKey | VIKXXPPEHSNWSN-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.96 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|