C7H5Br2FO — CID 141054271
1,2-dibromo-4-(fluoromethoxy)benzene (PubChem CID 141054271) has the molecular formula C7H5Br2FO and a molecular weight of 283.92 g/mol. Its IUPAC name is 1,2-dibromo-4-(fluoromethoxy)benzene.
| Compound Name | 1,2-dibromo-4-(fluoromethoxy)benzene |
|---|---|
| PubChem CID | 141054271 |
| Molecular Formula | C7H5Br2FO |
| Molecular Weight | 283.92 g/mol |
| Exact Mass | 281.87 |
| IUPAC Name | 1,2-dibromo-4-(fluoromethoxy)benzene |
| SMILES | FCOc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C7H5Br2FO/c8-6-2-1-5(11-4-10)3-7(6)9/h1-3H,4H2 |
| InChIKey | GGYJPXJTIYIMKZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.92 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |