C25H26I3N3O14S — CID 175084317
2-[[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-3-[3,5-diiodo-4-(3-iodo-4-sulfooxyphenoxy)phenyl]propanoic acid (PubChem CID 175084317) has the molecular formula C25H26I3N3O14S and a molecular weight of 1005.27 g/mol. Its IUPAC name is 2-[[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-3-[3,5-diiodo-4-(3-iodo-4-sulfooxyphenoxy)phenyl]propanoic acid.
| Compound Name | 2-[[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-3-[3,5-diiodo-4-(3-iodo-4-sulfooxyphenoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 175084317 |
| Molecular Formula | C25H26I3N3O14S |
| Molecular Weight | 1005.27 g/mol |
| Exact Mass | 1004.83 |
| IUPAC Name | 2-[[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-3-[3,5-diiodo-4-(3-iodo-4-sulfooxyphenoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)NC(Cc1cc(I)c(Oc2ccc(OS(=O)(=O)O)c(I)c2)c(I)c1)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C25H26I3N3O14S/c26-15-8-14(1-2-19(15)45-46(41,42)43)44-24-16(27)5-13(6-17(24)28)7-18(25(39)40)29-20(32)9-30(10-21(33)34)3-4-31(11-22(35)36)12-23(37)38/h1-2,5-6,8,18H,3-4,7,9-12H2,(H,29,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42,43) |
| InChIKey | DIKUSBHNPUIHOI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 257.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|