C25H29N7O — CID 175084816
3-(2,4-dimethylpyrimidin-5-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine;formamide (PubChem CID 175084816) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 3-(2,4-dimethylpyrimidin-5-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine;formamide.
| Compound Name | 3-(2,4-dimethylpyrimidin-5-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine;formamide |
|---|---|
| PubChem CID | 175084816 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 3-(2,4-dimethylpyrimidin-5-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine;formamide |
| SMILES | Cc1ncc(-c2c[nH]c3ncc(-c4ccc(N5CCN(C)CC5)cc4)cc23)c(C)n1.NC=O |
| InChI | InChI=1S/C24H26N6.CH3NO/c1-16-22(14-25-17(2)28-16)23-15-27-24-21(23)12-19(13-26-24)18-4-6-20(7-5-18)30-10-8-29(3)9-11-30;2-1-3/h4-7,12-15H,8-11H2,1-3H3,(H,26,27);1H,(H2,2,3) |
| InChIKey | XSUIJROPWYHJAF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|