About 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene
2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene (PubChem CID 175085079) has the molecular formula C18H25NS
and a molecular weight of 287.47 g/mol. Its IUPAC name is 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene.
Molecular Properties
| Compound Name | 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene |
| PubChem CID | 175085079 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene |
| SMILES | CCCc1ccccc1.Cc1cccc(C(C)N)c1S |
| InChI | InChI=1S/C9H13NS.C9H12/c1-6-4-3-5-8(7(2)10)9(6)11;1-2-6-9-7-4-3-5-8-9/h3-5,7,11H,10H2,1-2H3;3-5,7-8H,2,6H2,1H3 |
| InChIKey | UCQBTMPJDYIGDG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene?
The IUPAC name of 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene (CID 175085079) is 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene.
What is the SMILES notation for 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene?
The canonical SMILES for 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene is CCCc1ccccc1.Cc1cccc(C(C)N)c1S.
What is the InChIKey of 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene?
The InChIKey is UCQBTMPJDYIGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.C9H12/c1-6-4-3-5-8(7(2)10)9(6)11;1-2-6-9-7-4-3-5-8-9/h3-5,7,11H,10H2,1-2H3;3-5,7-8H,2,6H2,1H3.
What are the key properties of 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene?
2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene has a molecular weight of 287.47 g/mol, XLogP of 4.94, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminoethyl)-6-methylbenzenethiol;propylbenzene is sourced from PubChem (CID 175085079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).