C23H13ClF3NO2S — CID 175086016
6-chloro-3-[3-[3-[4-(trifluoromethyl)phenyl]phenyl]prop-2-enoyl]-1,3-benzothiazol-2-one (PubChem CID 175086016) has the molecular formula C23H13ClF3NO2S and a molecular weight of 459.88 g/mol. Its IUPAC name is 6-chloro-3-[3-[3-[4-(trifluoromethyl)phenyl]phenyl]prop-2-enoyl]-1,3-benzothiazol-2-one.
| Compound Name | 6-chloro-3-[3-[3-[4-(trifluoromethyl)phenyl]phenyl]prop-2-enoyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 175086016 |
| Molecular Formula | C23H13ClF3NO2S |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 6-chloro-3-[3-[3-[4-(trifluoromethyl)phenyl]phenyl]prop-2-enoyl]-1,3-benzothiazol-2-one |
| SMILES | O=C(C=Cc1cccc(-c2ccc(C(F)(F)F)cc2)c1)n1c(=O)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H13ClF3NO2S/c24-18-9-10-19-20(13-18)31-22(30)28(19)21(29)11-4-14-2-1-3-16(12-14)15-5-7-17(8-6-15)23(25,26)27/h1-13H |
| InChIKey | KLWBYRNABOLSKY-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|