About [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate
[3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate (PubChem CID 175090584) has the molecular formula C12H10BrNO4
and a molecular weight of 312.12 g/mol. Its IUPAC name is [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate.
Analyze [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate?
The IUPAC name of [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate (CID 175090584) is [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate.
What is the SMILES notation for [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate?
The canonical SMILES for [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate is COC(=O)Oc1c(-c2ccc(Br)cc2)noc1C.
What is the InChIKey of [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate?
The InChIKey is BSZMMJMQPAJXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNO4/c1-7-11(17-12(15)16-2)10(14-18-7)8-3-5-9(13)6-4-8/h3-6H,1-2H3.
What are the key properties of [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate?
[3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate has a molecular weight of 312.12 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromophenyl)-5-methyl-1,2-oxazol-4-yl] methyl carbonate is sourced from PubChem (CID 175090584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).