C18H16BrNO4 — CID 89366289
(2E,4E)-4-[3-(4-bromophenyl)-5-methyl-1,2-oxazole-4-carbonyl]-2-methylhexa-2,4-dienoic acid (PubChem CID 89366289) has the molecular formula C18H16BrNO4 and a molecular weight of 390.23 g/mol. Its IUPAC name is (2E,4E)-4-[3-(4-bromophenyl)-5-methyl-1,2-oxazole-4-carbonyl]-2-methylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-4-[3-(4-bromophenyl)-5-methyl-1,2-oxazole-4-carbonyl]-2-methylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 89366289 |
| Molecular Formula | C18H16BrNO4 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | (2E,4E)-4-[3-(4-bromophenyl)-5-methyl-1,2-oxazole-4-carbonyl]-2-methylhexa-2,4-dienoic acid |
| SMILES | C/C=C(\C=C(/C)C(=O)O)C(=O)c1c(-c2ccc(Br)cc2)noc1C |
| InChI | InChI=1S/C18H16BrNO4/c1-4-12(9-10(2)18(22)23)17(21)15-11(3)24-20-16(15)13-5-7-14(19)8-6-13/h4-9H,1-3H3,(H,22,23)/b10-9+,12-4+ |
| InChIKey | PXSBGSJSAUNILM-SVSYPLOBSA-N |
| XLogP | 4.57 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|