azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid

C14H31NO3 — CID 175093315

IUPACazane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid
SMILESCC(C)CCC(C)(CC(C)O)C(C)(C)C(=O)O.N
InChIInChI=1S/C14H28O3.H3N/c1-10(2)7-8-14(6,9-11(3)15)13(4,5)12(16)17;/h10-11,15H,7-9H2,1-6H3,(H,16,17);1H3
InChIKeyPMBFVWWMMBVPQA-UHFFFAOYSA-N
MW261.41 g/mol
LogP3.47
Rot. Bonds7

About azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid

azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid (PubChem CID 175093315) has the molecular formula C14H31NO3 and a molecular weight of 261.41 g/mol. Its IUPAC name is azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid.

Molecular Properties

Compound Nameazane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid
PubChem CID175093315
Molecular FormulaC14H31NO3
Molecular Weight261.41 g/mol
Exact Mass261.23
IUPAC Nameazane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid
SMILESCC(C)CCC(C)(CC(C)O)C(C)(C)C(=O)O.N
InChIInChI=1S/C14H28O3.H3N/c1-10(2)7-8-14(6,9-11(3)15)13(4,5)12(16)17;/h10-11,15H,7-9H2,1-6H3,(H,16,17);1H3
InChIKeyPMBFVWWMMBVPQA-UHFFFAOYSA-N
XLogP3.47
TPSA92.53 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.41
LogP ≤ 53.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid?
The IUPAC name of azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid (CID 175093315) is azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid.
What is the SMILES notation for azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid?
The canonical SMILES for azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid is CC(C)CCC(C)(CC(C)O)C(C)(C)C(=O)O.N.
What is the InChIKey of azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid?
The InChIKey is PMBFVWWMMBVPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3.H3N/c1-10(2)7-8-14(6,9-11(3)15)13(4,5)12(16)17;/h10-11,15H,7-9H2,1-6H3,(H,16,17);1H3.
What are the key properties of azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid?
azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid has a molecular weight of 261.41 g/mol, XLogP of 3.47, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid is sourced from PubChem (CID 175093315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).