C14H31NO3 — CID 175093315
azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid (PubChem CID 175093315) has the molecular formula C14H31NO3 and a molecular weight of 261.41 g/mol. Its IUPAC name is azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid.
| Compound Name | azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid |
|---|---|
| PubChem CID | 175093315 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | azane;3-(2-hydroxypropyl)-2,2,3,6-tetramethylheptanoic acid |
| SMILES | CC(C)CCC(C)(CC(C)O)C(C)(C)C(=O)O.N |
| InChI | InChI=1S/C14H28O3.H3N/c1-10(2)7-8-14(6,9-11(3)15)13(4,5)12(16)17;/h10-11,15H,7-9H2,1-6H3,(H,16,17);1H3 |
| InChIKey | PMBFVWWMMBVPQA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |