C5H5F6FeP-2 — CID 175093533
cyclopenta-1,3-diene;iron;hexafluorophosphate (PubChem CID 175093533) has the molecular formula C5H5F6FeP-2 and a molecular weight of 265.90 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron;hexafluorophosphate.
| Compound Name | cyclopenta-1,3-diene;iron;hexafluorophosphate |
|---|---|
| PubChem CID | 175093533 |
| Molecular Formula | C5H5F6FeP-2 |
| Molecular Weight | 265.90 g/mol |
| Exact Mass | 265.94 |
| IUPAC Name | cyclopenta-1,3-diene;iron;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[Fe].c1cc[cH-]c1 |
| InChI | InChI=1S/C5H5.F6P.Fe/c1-2-4-5-3-1;1-7(2,3,4,5)6;/h1-5H;;/q2*-1; |
| InChIKey | RHCHSZYXYMAWBZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.90 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|