C29H34N4O4 — CID 175093828
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-methyl-6-morpholin-4-yl-3-phenyl-N'-prop-2-enoylcyclohexa-2,4-diene-1-carbohydrazide (PubChem CID 175093828) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-methyl-6-morpholin-4-yl-3-phenyl-N'-prop-2-enoylcyclohexa-2,4-diene-1-carbohydrazide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-methyl-6-morpholin-4-yl-3-phenyl-N'-prop-2-enoylcyclohexa-2,4-diene-1-carbohydrazide |
|---|---|
| PubChem CID | 175093828 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-methyl-6-morpholin-4-yl-3-phenyl-N'-prop-2-enoylcyclohexa-2,4-diene-1-carbohydrazide |
| SMILES | C=CC(=O)NN(Cc1c(C)cc(C)[nH]c1=O)C(=O)C1C=C(c2ccccc2)C=CC1(C)N1CCOCC1 |
| InChI | InChI=1S/C29H34N4O4/c1-5-26(34)31-33(19-24-20(2)17-21(3)30-27(24)35)28(36)25-18-23(22-9-7-6-8-10-22)11-12-29(25,4)32-13-15-37-16-14-32/h5-12,17-18,25H,1,13-16,19H2,2-4H3,(H,30,35)(H,31,34) |
| InChIKey | CWBGBEPZSQQHIW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|