C10H12N2 — CID 175095411
1-cyclopenta-2,4-dien-1-yl-2-ethylimidazole (PubChem CID 175095411) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-2-ethylimidazole.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-2-ethylimidazole |
|---|---|
| PubChem CID | 175095411 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-2-ethylimidazole |
| SMILES | CCc1nccn1C1C=CC=C1 |
| InChI | InChI=1S/C10H12N2/c1-2-10-11-7-8-12(10)9-5-3-4-6-9/h3-9H,2H2,1H3 |
| InChIKey | BBKVJZVISPQBPZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |