About (5E)-1,1-diethoxynona-1,5-dien-3-yne
(5E)-1,1-diethoxynona-1,5-dien-3-yne (PubChem CID 175096031) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is (5E)-1,1-diethoxynona-1,5-dien-3-yne.
Molecular Properties
| Compound Name | (5E)-1,1-diethoxynona-1,5-dien-3-yne |
| PubChem CID | 175096031 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (5E)-1,1-diethoxynona-1,5-dien-3-yne |
| SMILES | CCC/C=C/C#CC=C(OCC)OCC |
| InChI | InChI=1S/C13H20O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h8-9,12H,4-7H2,1-3H3/b9-8+ |
| InChIKey | GDHOPPCOOIYDBL-CMDGGOBGSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-1,1-diethoxynona-1,5-dien-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-1,1-diethoxynona-1,5-dien-3-yne?
The IUPAC name of (5E)-1,1-diethoxynona-1,5-dien-3-yne (CID 175096031) is (5E)-1,1-diethoxynona-1,5-dien-3-yne.
What is the SMILES notation for (5E)-1,1-diethoxynona-1,5-dien-3-yne?
The canonical SMILES for (5E)-1,1-diethoxynona-1,5-dien-3-yne is CCC/C=C/C#CC=C(OCC)OCC.
What is the InChIKey of (5E)-1,1-diethoxynona-1,5-dien-3-yne?
The InChIKey is GDHOPPCOOIYDBL-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H20O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h8-9,12H,4-7H2,1-3H3/b9-8+.
What are the key properties of (5E)-1,1-diethoxynona-1,5-dien-3-yne?
(5E)-1,1-diethoxynona-1,5-dien-3-yne has a molecular weight of 208.30 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-1,1-diethoxynona-1,5-dien-3-yne is sourced from PubChem (CID 175096031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).