C13H20O2 — CID 175096031
(5E)-1,1-diethoxynona-1,5-dien-3-yne (PubChem CID 175096031) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (5E)-1,1-diethoxynona-1,5-dien-3-yne.
| Compound Name | (5E)-1,1-diethoxynona-1,5-dien-3-yne |
|---|---|
| PubChem CID | 175096031 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (5E)-1,1-diethoxynona-1,5-dien-3-yne |
| SMILES | CCC/C=C/C#CC=C(OCC)OCC |
| InChI | InChI=1S/C13H20O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h8-9,12H,4-7H2,1-3H3/b9-8+ |
| InChIKey | GDHOPPCOOIYDBL-CMDGGOBGSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|