C6H11Br3GeO2 — CID 13211555
tribromo(2,2-diethoxyethenyl)germane (PubChem CID 13211555) has the molecular formula C6H11Br3GeO2 and a molecular weight of 427.47 g/mol. Its IUPAC name is tribromo(2,2-diethoxyethenyl)germane.
| Compound Name | tribromo(2,2-diethoxyethenyl)germane |
|---|---|
| PubChem CID | 13211555 |
| Molecular Formula | C6H11Br3GeO2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 425.75 |
| IUPAC Name | tribromo(2,2-diethoxyethenyl)germane |
| SMILES | CCOC(=C[Ge](Br)(Br)Br)OCC |
| InChI | InChI=1S/C6H11Br3GeO2/c1-3-11-6(12-4-2)5-10(7,8)9/h5H,3-4H2,1-2H3 |
| InChIKey | LZLHDTLWBNPGHO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|