C22H25BrN4O5 — CID 175096162
tert-butyl N-[1-[3-(4-bromo-3-pyridinyl)-2-nitrobenzoyl]piperidin-3-yl]carbamate (PubChem CID 175096162) has the molecular formula C22H25BrN4O5 and a molecular weight of 505.37 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(4-bromo-3-pyridinyl)-2-nitrobenzoyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(4-bromo-3-pyridinyl)-2-nitrobenzoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 175096162 |
| Molecular Formula | C22H25BrN4O5 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | tert-butyl N-[1-[3-(4-bromo-3-pyridinyl)-2-nitrobenzoyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(C(=O)c2cccc(-c3cnccc3Br)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H25BrN4O5/c1-22(2,3)32-21(29)25-14-6-5-11-26(13-14)20(28)16-8-4-7-15(19(16)27(30)31)17-12-24-10-9-18(17)23/h4,7-10,12,14H,5-6,11,13H2,1-3H3,(H,25,29) |
| InChIKey | XMKVZSQQIMZLGZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|