C21H27N5O4 — CID 175097502
8-[(E)-2-[6-(2-ethoxyethoxy)-3-pyridinyl]ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione (PubChem CID 175097502) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is 8-[(E)-2-[6-(2-ethoxyethoxy)-3-pyridinyl]ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione.
| Compound Name | 8-[(E)-2-[6-(2-ethoxyethoxy)-3-pyridinyl]ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 175097502 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 8-[(E)-2-[6-(2-ethoxyethoxy)-3-pyridinyl]ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione |
| SMILES | CCOCCOc1ccc(/C=C/c2nc3c(c(=O)n(CC)c(=O)n3CC)n2C)cn1 |
| InChI | InChI=1S/C21H27N5O4/c1-5-25-19-18(20(27)26(6-2)21(25)28)24(4)16(23-19)10-8-15-9-11-17(22-14-15)30-13-12-29-7-3/h8-11,14H,5-7,12-13H2,1-4H3/b10-8+ |
| InChIKey | ALDVGVZLBCEKRP-CSKARUKUSA-N |
| XLogP | 1.92 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|