C17H20N6O3 — CID 175091765
1,3-diethyl-8-[(E)-2-(2-methoxypyrimidin-5-yl)ethenyl]-7-methylpurine-2,6-dione (PubChem CID 175091765) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1,3-diethyl-8-[(E)-2-(2-methoxypyrimidin-5-yl)ethenyl]-7-methylpurine-2,6-dione.
| Compound Name | 1,3-diethyl-8-[(E)-2-(2-methoxypyrimidin-5-yl)ethenyl]-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 175091765 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1,3-diethyl-8-[(E)-2-(2-methoxypyrimidin-5-yl)ethenyl]-7-methylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(/C=C/c3cnc(OC)nc3)n2C)n(CC)c1=O |
| InChI | InChI=1S/C17H20N6O3/c1-5-22-14-13(15(24)23(6-2)17(22)25)21(3)12(20-14)8-7-11-9-18-16(26-4)19-10-11/h7-10H,5-6H2,1-4H3/b8-7+ |
| InChIKey | GZFHRTTXIKRNKL-BQYQJAHWSA-N |
| XLogP | 0.91 |
| TPSA | 96.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|