C22H26N4O5 — CID 54445918
[4-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenyl] propanoate (PubChem CID 54445918) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is [4-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenyl] propanoate.
| Compound Name | [4-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenyl] propanoate |
|---|---|
| PubChem CID | 54445918 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [4-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C=Cc2nc3c(c(=O)n(CC)c(=O)n3CC)n2C)cc1OC |
| InChI | InChI=1S/C22H26N4O5/c1-6-18(27)31-15-11-9-14(13-16(15)30-5)10-12-17-23-20-19(24(17)4)21(28)26(8-3)22(29)25(20)7-2/h9-13H,6-8H2,1-5H3 |
| InChIKey | WRMODMAYEWGJTP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|