C28H38N6O6 — CID 142762775
2-[4-[(E)-2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenoxy]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 142762775) has the molecular formula C28H38N6O6 and a molecular weight of 554.65 g/mol. Its IUPAC name is 2-[4-[(E)-2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenoxy]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[4-[(E)-2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenoxy]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 142762775 |
| Molecular Formula | C28H38N6O6 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 2-[4-[(E)-2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-2-methoxyphenoxy]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | CCn1c(=O)c2c(nc(/C=C/c3ccc(OCC(=O)NCCCN4CCOCC4)c(OC)c3)n2C)n(CC)c1=O |
| InChI | InChI=1S/C28H38N6O6/c1-5-33-26-25(27(36)34(6-2)28(33)37)31(3)23(30-26)11-9-20-8-10-21(22(18-20)38-4)40-19-24(35)29-12-7-13-32-14-16-39-17-15-32/h8-11,18H,5-7,12-17,19H2,1-4H3,(H,29,35)/b11-9+ |
| InChIKey | GSJLOYDRMMZOIY-PKNBQFBNSA-N |
| XLogP | 1.33 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|