C41H50N8O7 — CID 159856248
8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,7-dimethyl-3-propylpurine-2,6-dione;ethene;3-ethyl-8-[(E)-2-(3-methoxy-4-methylphenyl)ethenyl]-1,7-dimethylpurine-2,6-dione (PubChem CID 159856248) has the molecular formula C41H50N8O7 and a molecular weight of 766.90 g/mol. Its IUPAC name is 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,7-dimethyl-3-propylpurine-2,6-dione;ethene;3-ethyl-8-[(E)-2-(3-methoxy-4-methylphenyl)ethenyl]-1,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,7-dimethyl-3-propylpurine-2,6-dione;ethene;3-ethyl-8-[(E)-2-(3-methoxy-4-methylphenyl)ethenyl]-1,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 159856248 |
| Molecular Formula | C41H50N8O7 |
| Molecular Weight | 766.90 g/mol |
| Exact Mass | 766.38 |
| IUPAC Name | 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,7-dimethyl-3-propylpurine-2,6-dione;ethene;3-ethyl-8-[(E)-2-(3-methoxy-4-methylphenyl)ethenyl]-1,7-dimethylpurine-2,6-dione |
| SMILES | C=C.CCCn1c(=O)n(C)c(=O)c2c1nc(/C=C/c1ccc(OC)c(OC)c1)n2C.CCn1c(=O)n(C)c(=O)c2c1nc(/C=C/c1ccc(C)c(OC)c1)n2C |
| InChI | InChI=1S/C20H24N4O4.C19H22N4O3.C2H4/c1-6-11-24-18-17(19(25)23(3)20(24)26)22(2)16(21-18)10-8-13-7-9-14(27-4)15(12-13)28-5;1-6-23-17-16(18(24)22(4)19(23)25)21(3)15(20-17)10-9-13-8-7-12(2)14(11-13)26-5;1-2/h7-10,12H,6,11H2,1-5H3;7-11H,6H2,1-5H3;1-2H2/b10-8+;10-9+; |
| InChIKey | NQOJWZZCYURWPW-GBQVHQJXSA-N |
| XLogP | 4.77 |
| TPSA | 151.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|