C21H24N4O5 — CID 54536317
[2-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-6-methoxyphenyl] acetate (PubChem CID 54536317) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-6-methoxyphenyl] acetate.
| Compound Name | [2-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 54536317 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-[2-(1,3-diethyl-7-methyl-2,6-dioxopurin-8-yl)ethenyl]-6-methoxyphenyl] acetate |
| SMILES | CCn1c(=O)c2c(nc(C=Cc3cccc(OC)c3OC(C)=O)n2C)n(CC)c1=O |
| InChI | InChI=1S/C21H24N4O5/c1-6-24-19-17(20(27)25(7-2)21(24)28)23(4)16(22-19)12-11-14-9-8-10-15(29-5)18(14)30-13(3)26/h8-12H,6-7H2,1-5H3 |
| InChIKey | ZAAIJPRUJVIJHB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|