C22H21BrF2N2O3S2 — CID 175097552
2-[3-bromo-2,6-difluoro-4-[1-[(1R)-1-phenylethyl]piperidin-4-yl]oxyphenyl]sulfonyl-1,3-thiazole (PubChem CID 175097552) has the molecular formula C22H21BrF2N2O3S2 and a molecular weight of 543.46 g/mol. Its IUPAC name is 2-[3-bromo-2,6-difluoro-4-[1-[(1R)-1-phenylethyl]piperidin-4-yl]oxyphenyl]sulfonyl-1,3-thiazole.
| Compound Name | 2-[3-bromo-2,6-difluoro-4-[1-[(1R)-1-phenylethyl]piperidin-4-yl]oxyphenyl]sulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 175097552 |
| Molecular Formula | C22H21BrF2N2O3S2 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | 2-[3-bromo-2,6-difluoro-4-[1-[(1R)-1-phenylethyl]piperidin-4-yl]oxyphenyl]sulfonyl-1,3-thiazole |
| SMILES | C[C@H](c1ccccc1)N1CCC(Oc2cc(F)c(S(=O)(=O)c3nccs3)c(F)c2Br)CC1 |
| InChI | InChI=1S/C22H21BrF2N2O3S2/c1-14(15-5-3-2-4-6-15)27-10-7-16(8-11-27)30-18-13-17(24)21(20(25)19(18)23)32(28,29)22-26-9-12-31-22/h2-6,9,12-14,16H,7-8,10-11H2,1H3/t14-/m1/s1 |
| InChIKey | MLYRLBXVTUVGIY-CQSZACIVSA-N |
| XLogP | 5.62 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|