C19H32O8 — CID 175100240
ethane-1,2-diol;3-methyloctane-4,4-diol;terephthalic acid (PubChem CID 175100240) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is ethane-1,2-diol;3-methyloctane-4,4-diol;terephthalic acid.
| Compound Name | ethane-1,2-diol;3-methyloctane-4,4-diol;terephthalic acid |
|---|---|
| PubChem CID | 175100240 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | ethane-1,2-diol;3-methyloctane-4,4-diol;terephthalic acid |
| SMILES | CCCCC(O)(O)C(C)CC.O=C(O)c1ccc(C(=O)O)cc1.OCCO |
| InChI | InChI=1S/C9H20O2.C8H6O4.C2H6O2/c1-4-6-7-9(10,11)8(3)5-2;9-7(10)5-1-2-6(4-3-5)8(11)12;3-1-2-4/h8,10-11H,4-7H2,1-3H3;1-4H,(H,9,10)(H,11,12);3-4H,1-2H2 |
| InChIKey | CSLSPIQZHHNJNA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|