C14H21NO4S — CID 175100507
1-phenyl-2-prop-2-enylpent-4-en-1-amine;sulfuric acid (PubChem CID 175100507) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 1-phenyl-2-prop-2-enylpent-4-en-1-amine;sulfuric acid.
| Compound Name | 1-phenyl-2-prop-2-enylpent-4-en-1-amine;sulfuric acid |
|---|---|
| PubChem CID | 175100507 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-phenyl-2-prop-2-enylpent-4-en-1-amine;sulfuric acid |
| SMILES | C=CCC(CC=C)C(N)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C14H19N.H2O4S/c1-3-8-12(9-4-2)14(15)13-10-6-5-7-11-13;1-5(2,3)4/h3-7,10-12,14H,1-2,8-9,15H2;(H2,1,2,3,4) |
| InChIKey | AYPBSXVZVUSEQP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|