C14H16ClNO4 — CID 175105023
5-(hydroxymethyl)-4-[hydroxy(phenoxy)methyl]-2-methylpyridin-3-ol;hydrochloride (PubChem CID 175105023) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-[hydroxy(phenoxy)methyl]-2-methylpyridin-3-ol;hydrochloride.
| Compound Name | 5-(hydroxymethyl)-4-[hydroxy(phenoxy)methyl]-2-methylpyridin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 175105023 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-(hydroxymethyl)-4-[hydroxy(phenoxy)methyl]-2-methylpyridin-3-ol;hydrochloride |
| SMILES | Cc1ncc(CO)c(C(O)Oc2ccccc2)c1O.Cl |
| InChI | InChI=1S/C14H15NO4.ClH/c1-9-13(17)12(10(8-16)7-15-9)14(18)19-11-5-3-2-4-6-11;/h2-7,14,16-18H,8H2,1H3;1H |
| InChIKey | UPMNNGNEJJYLGQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|