C20H18F4N2O5 — CID 175106453
ethyl 4,4,4-trifluoro-2-[(2-fluorophenyl)carbamoyl]-3-(nitromethyl)-3-phenylbutanoate (PubChem CID 175106453) has the molecular formula C20H18F4N2O5 and a molecular weight of 442.37 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-2-[(2-fluorophenyl)carbamoyl]-3-(nitromethyl)-3-phenylbutanoate.
| Compound Name | ethyl 4,4,4-trifluoro-2-[(2-fluorophenyl)carbamoyl]-3-(nitromethyl)-3-phenylbutanoate |
|---|---|
| PubChem CID | 175106453 |
| Molecular Formula | C20H18F4N2O5 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | ethyl 4,4,4-trifluoro-2-[(2-fluorophenyl)carbamoyl]-3-(nitromethyl)-3-phenylbutanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1ccccc1F)C(C[N+](=O)[O-])(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H18F4N2O5/c1-2-31-18(28)16(17(27)25-15-11-7-6-10-14(15)21)19(12-26(29)30,20(22,23)24)13-8-4-3-5-9-13/h3-11,16H,2,12H2,1H3,(H,25,27) |
| InChIKey | LHRICCZBAMHXRK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|