C17H17NO2 — CID 175106521
2-(1,3-benzodioxol-5-yl)-2-methyl-3,4-dihydro-1H-quinoline (PubChem CID 175106521) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-methyl-3,4-dihydro-1H-quinoline.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-methyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 175106521 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-methyl-3,4-dihydro-1H-quinoline |
| SMILES | CC1(c2ccc3c(c2)OCO3)CCc2ccccc2N1 |
| InChI | InChI=1S/C17H17NO2/c1-17(9-8-12-4-2-3-5-14(12)18-17)13-6-7-15-16(10-13)20-11-19-15/h2-7,10,18H,8-9,11H2,1H3 |
| InChIKey | FRBSHESUTZPNDK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |