dimethylsilane;methyl hydrogen carbonate

C4H12O3Si — CID 175108197

IUPACdimethylsilane;methyl hydrogen carbonate
SMILESCOC(=O)O.C[SiH2]C
InChIInChI=1S/C2H4O3.C2H8Si/c1-5-2(3)4;1-3-2/h1H3,(H,3,4);3H2,1-2H3
InChIKeyVGWRZCFWICQVHQ-UHFFFAOYSA-N
MW136.22 g/mol
LogP0.56
Rot. Bonds

About dimethylsilane;methyl hydrogen carbonate

dimethylsilane;methyl hydrogen carbonate (PubChem CID 175108197) has the molecular formula C4H12O3Si and a molecular weight of 136.22 g/mol. Its IUPAC name is dimethylsilane;methyl hydrogen carbonate.

Molecular Properties

Compound Namedimethylsilane;methyl hydrogen carbonate
PubChem CID175108197
Molecular FormulaC4H12O3Si
Molecular Weight136.22 g/mol
Exact Mass136.06
IUPAC Namedimethylsilane;methyl hydrogen carbonate
SMILESCOC(=O)O.C[SiH2]C
InChIInChI=1S/C2H4O3.C2H8Si/c1-5-2(3)4;1-3-2/h1H3,(H,3,4);3H2,1-2H3
InChIKeyVGWRZCFWICQVHQ-UHFFFAOYSA-N
XLogP0.56
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500136.22
LogP ≤ 50.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze dimethylsilane;methyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

carbonic acid;methyl hydrogen carbonate
CID 175554276
methyl hydrogen carbonate;propan-2-one
CID 157174234
dichloromethane;methyl hydrogen carbonate
CID 160547489
methyl hydrogen carbonate;sulfuric acid
CID 172863213
dimethylsilane;oxalic acid
CID 174988732
(2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate
CID 158096678
sodium;hydride;methyl hydrogen carbonate;hexatetrafluoroborate
CID 175034808
methyl hydrogen carbonate;2,2,2-trifluoroacetic acid
CID 158638631
acetic acid;formaldehyde;methane;methanethione;methyl hydrogen carbonate;hydrochloride
CID 158790484
2-methoxyethanol;methyl hydrogen carbonate
CID 160714037
methyl hydrogen carbonate;phenol
CID 126664263
methoxy hydrogen carbonate
CID 19018247

Frequently Asked Questions

What is the IUPAC name of dimethylsilane;methyl hydrogen carbonate?
The IUPAC name of dimethylsilane;methyl hydrogen carbonate (CID 175108197) is dimethylsilane;methyl hydrogen carbonate.
What is the SMILES notation for dimethylsilane;methyl hydrogen carbonate?
The canonical SMILES for dimethylsilane;methyl hydrogen carbonate is COC(=O)O.C[SiH2]C.
What is the InChIKey of dimethylsilane;methyl hydrogen carbonate?
The InChIKey is VGWRZCFWICQVHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.C2H8Si/c1-5-2(3)4;1-3-2/h1H3,(H,3,4);3H2,1-2H3.
What are the key properties of dimethylsilane;methyl hydrogen carbonate?
dimethylsilane;methyl hydrogen carbonate has a molecular weight of 136.22 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilane;methyl hydrogen carbonate is sourced from PubChem (CID 175108197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).