About dimethylsilane;methyl hydrogen carbonate
dimethylsilane;methyl hydrogen carbonate (PubChem CID 175108197) has the molecular formula C4H12O3Si
and a molecular weight of 136.22 g/mol. Its IUPAC name is dimethylsilane;methyl hydrogen carbonate.
Molecular Properties
| Compound Name | dimethylsilane;methyl hydrogen carbonate |
| PubChem CID | 175108197 |
| Molecular Formula | C4H12O3Si |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | dimethylsilane;methyl hydrogen carbonate |
| SMILES | COC(=O)O.C[SiH2]C |
| InChI | InChI=1S/C2H4O3.C2H8Si/c1-5-2(3)4;1-3-2/h1H3,(H,3,4);3H2,1-2H3 |
| InChIKey | VGWRZCFWICQVHQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilane;methyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilane;methyl hydrogen carbonate?
The IUPAC name of dimethylsilane;methyl hydrogen carbonate (CID 175108197) is dimethylsilane;methyl hydrogen carbonate.
What is the SMILES notation for dimethylsilane;methyl hydrogen carbonate?
The canonical SMILES for dimethylsilane;methyl hydrogen carbonate is COC(=O)O.C[SiH2]C.
What is the InChIKey of dimethylsilane;methyl hydrogen carbonate?
The InChIKey is VGWRZCFWICQVHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.C2H8Si/c1-5-2(3)4;1-3-2/h1H3,(H,3,4);3H2,1-2H3.
What are the key properties of dimethylsilane;methyl hydrogen carbonate?
dimethylsilane;methyl hydrogen carbonate has a molecular weight of 136.22 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilane;methyl hydrogen carbonate is sourced from PubChem (CID 175108197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).