About (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate
(2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate (PubChem CID 158096678) has the molecular formula C5H10O6
and a molecular weight of 166.13 g/mol. Its IUPAC name is (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate.
Molecular Properties
| Compound Name | (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate |
| PubChem CID | 158096678 |
| Molecular Formula | C5H10O6 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate |
| SMILES | COC(=O)O.C[C@H](O)C(=O)O |
| InChI | InChI=1S/C3H6O3.C2H4O3/c1-2(4)3(5)6;1-5-2(3)4/h2,4H,1H3,(H,5,6);1H3,(H,3,4)/t2-;/m0./s1 |
| InChIKey | FOTDWUYFEVEGFR-DKWTVANSSA-N |
| XLogP | -0.24 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate?
The IUPAC name of (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate (CID 158096678) is (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate.
What is the SMILES notation for (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate?
The canonical SMILES for (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate is COC(=O)O.C[C@H](O)C(=O)O.
What is the InChIKey of (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate?
The InChIKey is FOTDWUYFEVEGFR-DKWTVANSSA-N. The full InChI is InChI=1S/C3H6O3.C2H4O3/c1-2(4)3(5)6;1-5-2(3)4/h2,4H,1H3,(H,5,6);1H3,(H,3,4)/t2-;/m0./s1.
What are the key properties of (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate?
(2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate has a molecular weight of 166.13 g/mol, XLogP of -0.24, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-hydroxypropanoic acid;methyl hydrogen carbonate is sourced from PubChem (CID 158096678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).