C9H9F3N2O5S2 — CID 175108202
2-[4-(trifluoromethoxy)phenyl]ethene-1,1-disulfonamide (PubChem CID 175108202) has the molecular formula C9H9F3N2O5S2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]ethene-1,1-disulfonamide.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]ethene-1,1-disulfonamide |
|---|---|
| PubChem CID | 175108202 |
| Molecular Formula | C9H9F3N2O5S2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]ethene-1,1-disulfonamide |
| SMILES | NS(=O)(=O)C(=Cc1ccc(OC(F)(F)F)cc1)S(N)(=O)=O |
| InChI | InChI=1S/C9H9F3N2O5S2/c10-9(11,12)19-7-3-1-6(2-4-7)5-8(20(13,15)16)21(14,17)18/h1-5H,(H2,13,15,16)(H2,14,17,18) |
| InChIKey | YJDVIKBQUNWGMI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |